C18H23N3O8 — CID 20779685
(2,5-dioxopyrrolidin-1-yl) 5-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]pentanoate (PubChem CID 20779685) has the molecular formula C18H23N3O8 and a molecular weight of 409.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]pentanoate |
|---|---|
| PubChem CID | 20779685 |
| Molecular Formula | C18H23N3O8 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]pentanoate |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCOCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C18H23N3O8/c22-13(8-10-20-14(23)4-5-15(20)24)19-9-12-28-11-2-1-3-18(27)29-21-16(25)6-7-17(21)26/h4-5H,1-3,6-12H2,(H,19,22) |
| InChIKey | FJMLHQHRDJEEJS-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|