C20H32BrN3O9 — CID 87561673
(2,5-dioxopyrrolidin-1-yl) 6-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethylamino]-6-oxohexanoate (PubChem CID 87561673) has the molecular formula C20H32BrN3O9 and a molecular weight of 538.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethylamino]-6-oxohexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 87561673 |
| Molecular Formula | C20H32BrN3O9 |
| Molecular Weight | 538.39 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethylamino]-6-oxohexanoate |
| SMILES | O=C(CBr)NCCOCCOCCOCCNC(=O)CCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H32BrN3O9/c21-15-17(26)23-8-10-31-12-14-32-13-11-30-9-7-22-16(25)3-1-2-4-20(29)33-24-18(27)5-6-19(24)28/h1-15H2,(H,22,25)(H,23,26) |
| InChIKey | GIONVMNQILQMNC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|