C24H41N3O10 — CID 135199706
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(8-formamidooctanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 135199706) has the molecular formula C24H41N3O10 and a molecular weight of 531.60 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(8-formamidooctanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(8-formamidooctanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 135199706 |
| Molecular Formula | C24H41N3O10 |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(8-formamidooctanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | O=CNCCCCCCCC(=O)NCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H41N3O10/c28-20-25-10-5-3-1-2-4-6-21(29)26-11-13-34-15-17-36-19-18-35-16-14-33-12-9-24(32)37-27-22(30)7-8-23(27)31/h20H,1-19H2,(H,25,28)(H,26,29) |
| InChIKey | YHEZXELMEOJFKA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|