C19H32N2O9 — CID 129271799
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(butanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 129271799) has the molecular formula C19H32N2O9 and a molecular weight of 432.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(butanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(butanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 129271799 |
| Molecular Formula | C19H32N2O9 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(butanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CCCC(=O)NCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H32N2O9/c1-2-3-16(22)20-7-9-27-11-13-29-15-14-28-12-10-26-8-6-19(25)30-21-17(23)4-5-18(21)24/h2-15H2,1H3,(H,20,22) |
| InChIKey | BHFWIXJWQDCOBY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|