C17H29N3O8 — CID 134424013
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[3-(methylamino)propanoylamino]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 134424013) has the molecular formula C17H29N3O8 and a molecular weight of 403.43 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[3-(methylamino)propanoylamino]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[3-(methylamino)propanoylamino]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 134424013 |
| Molecular Formula | C17H29N3O8 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[3-(methylamino)propanoylamino]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CNCCC(=O)NCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H29N3O8/c1-18-6-4-14(21)19-7-9-26-11-13-27-12-10-25-8-5-17(24)28-20-15(22)2-3-16(20)23/h18H,2-13H2,1H3,(H,19,21) |
| InChIKey | CDHNGQMXPMOPHG-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|