C53H88N4O12 — CID 157110629
(2,5-dioxopyrrolidin-1-yl) 17-[[20-[[8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctyl]amino]-11,20-dioxoicosanoyl]amino]-10-oxoheptadecanoate (PubChem CID 157110629) has the molecular formula C53H88N4O12 and a molecular weight of 973.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 17-[[20-[[8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctyl]amino]-11,20-dioxoicosanoyl]amino]-10-oxoheptadecanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 17-[[20-[[8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctyl]amino]-11,20-dioxoicosanoyl]amino]-10-oxoheptadecanoate |
|---|---|
| PubChem CID | 157110629 |
| Molecular Formula | C53H88N4O12 |
| Molecular Weight | 973.30 g/mol |
| Exact Mass | 972.64 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 17-[[20-[[8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctyl]amino]-11,20-dioxoicosanoyl]amino]-10-oxoheptadecanoate |
| SMILES | O=C(CCCCCCCCCC(=O)NCCCCCCCC(=O)CCCCCCCCC(=O)ON1C(=O)CCC1=O)CCCCCCCCC(=O)NCCCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C53H88N4O12/c58-44(31-21-11-4-6-15-25-35-47(61)55-43-29-19-9-17-27-37-53(67)69-57-50(64)40-41-51(57)65)30-20-10-2-1-3-14-24-34-46(60)54-42-28-18-8-13-23-33-45(59)32-22-12-5-7-16-26-36-52(66)68-56-48(62)38-39-49(56)63/h1-43H2,(H,54,60)(H,55,61) |
| InChIKey | DEQIMNDHZWUCSD-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 219.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.30 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|