C15H28N2O6Si2 — CID 163761392
(2,5-dioxopyrrolidin-1-yl) 6-[3-[dimethyl(silyloxy)silyl]propylamino]-6-oxohexanoate (PubChem CID 163761392) has the molecular formula C15H28N2O6Si2 and a molecular weight of 388.57 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[3-[dimethyl(silyloxy)silyl]propylamino]-6-oxohexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-[dimethyl(silyloxy)silyl]propylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 163761392 |
| Molecular Formula | C15H28N2O6Si2 |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-[dimethyl(silyloxy)silyl]propylamino]-6-oxohexanoate |
| SMILES | C[Si](C)(CCCNC(=O)CCCCC(=O)ON1C(=O)CCC1=O)O[SiH3] |
| InChI | InChI=1S/C15H28N2O6Si2/c1-25(2,23-24)11-5-10-16-12(18)6-3-4-7-15(21)22-17-13(19)8-9-14(17)20/h3-11H2,1-2,24H3,(H,16,18) |
| InChIKey | ARKOJPGOPNIIGX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|