C20H36N2O6Si — CID 24826459
(2,5-dioxopyrrolidin-1-yl) 5-[3-[ethoxy-di(propan-2-yl)silyl]propylamino]-5-oxopentanoate (PubChem CID 24826459) has the molecular formula C20H36N2O6Si and a molecular weight of 428.60 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-[3-[ethoxy-di(propan-2-yl)silyl]propylamino]-5-oxopentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-[3-[ethoxy-di(propan-2-yl)silyl]propylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 24826459 |
| Molecular Formula | C20H36N2O6Si |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-[3-[ethoxy-di(propan-2-yl)silyl]propylamino]-5-oxopentanoate |
| SMILES | CCO[Si](CCCNC(=O)CCCC(=O)ON1C(=O)CCC1=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H36N2O6Si/c1-6-27-29(15(2)3,16(4)5)14-8-13-21-17(23)9-7-10-20(26)28-22-18(24)11-12-19(22)25/h15-16H,6-14H2,1-5H3,(H,21,23) |
| InChIKey | WVSHBZSGPPBTLG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|