C14H21N3O6 — CID 170024756
(2,5-dioxopyrrolidin-1-yl) 5-[[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoate (PubChem CID 170024756) has the molecular formula C14H21N3O6 and a molecular weight of 327.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-[[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-[[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 170024756 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-[[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoate |
| SMILES | CC(C)[C@@H](NC(=O)CCCC(=O)ON1C(=O)CCC1=O)C(N)=O |
| InChI | InChI=1S/C14H21N3O6/c1-8(2)13(14(15)22)16-9(18)4-3-5-12(21)23-17-10(19)6-7-11(17)20/h8,13H,3-7H2,1-2H3,(H2,15,22)(H,16,18)/t13-/m1/s1 |
| InChIKey | FIUNTMZMQHBRCR-CYBMUJFWSA-N |
| XLogP | -0.61 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|