C15H22N2O7 — CID 88773797
methyl (2S,3S)-2-[[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]amino]-3-methylpentanoate (PubChem CID 88773797) has the molecular formula C15H22N2O7 and a molecular weight of 342.35 g/mol. Its IUPAC name is methyl (2S,3S)-2-[[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]amino]-3-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-[[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 88773797 |
| Molecular Formula | C15H22N2O7 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | methyl (2S,3S)-2-[[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)CCC(=O)ON1C(=O)CCC1=O)C(=O)OC |
| InChI | InChI=1S/C15H22N2O7/c1-4-9(2)14(15(22)23-3)16-10(18)5-8-13(21)24-17-11(19)6-7-12(17)20/h9,14H,4-8H2,1-3H3,(H,16,18)/t9-,14-/m0/s1 |
| InChIKey | ILLZFDKOKHMFNW-XPTSAGLGSA-N |
| XLogP | 0.08 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|