C18H20N2O10 — CID 87362127
bis(2,5-dioxopyrrolidin-1-yl) 4,7-dioxodecanedioate (PubChem CID 87362127) has the molecular formula C18H20N2O10 and a molecular weight of 424.36 g/mol. Its IUPAC name is bis(2,5-dioxopyrrolidin-1-yl) 4,7-dioxodecanedioate.
| Compound Name | bis(2,5-dioxopyrrolidin-1-yl) 4,7-dioxodecanedioate |
|---|---|
| PubChem CID | 87362127 |
| Molecular Formula | C18H20N2O10 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | bis(2,5-dioxopyrrolidin-1-yl) 4,7-dioxodecanedioate |
| SMILES | O=C(CCC(=O)CCC(=O)ON1C(=O)CCC1=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C18H20N2O10/c21-11(3-9-17(27)29-19-13(23)5-6-14(19)24)1-2-12(22)4-10-18(28)30-20-15(25)7-8-16(20)26/h1-10H2 |
| InChIKey | TWVNDDLZLIHRGP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 161.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|