C10H12BrNO5 — CID 149046633
(2,5-dioxopyrrolidin-1-yl) 6-bromo-5-oxohexanoate (PubChem CID 149046633) has the molecular formula C10H12BrNO5 and a molecular weight of 306.11 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-bromo-5-oxohexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-bromo-5-oxohexanoate |
|---|---|
| PubChem CID | 149046633 |
| Molecular Formula | C10H12BrNO5 |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-bromo-5-oxohexanoate |
| SMILES | O=C(CBr)CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H12BrNO5/c11-6-7(13)2-1-3-10(16)17-12-8(14)4-5-9(12)15/h1-6H2 |
| InChIKey | QISJVTXLTATKPG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|