C22H28N2O12 — CID 163776671
(2,5-dioxopyrrolidin-1-yl) 6-[2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-2,6-dioxohexoxy]ethoxy]-5-oxohexanoate (PubChem CID 163776671) has the molecular formula C22H28N2O12 and a molecular weight of 512.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-2,6-dioxohexoxy]ethoxy]-5-oxohexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-2,6-dioxohexoxy]ethoxy]-5-oxohexanoate |
|---|---|
| PubChem CID | 163776671 |
| Molecular Formula | C22H28N2O12 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-2,6-dioxohexoxy]ethoxy]-5-oxohexanoate |
| SMILES | O=C(CCCC(=O)ON1C(=O)CCC1=O)COCCOCC(=O)CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C22H28N2O12/c25-15(3-1-5-21(31)35-23-17(27)7-8-18(23)28)13-33-11-12-34-14-16(26)4-2-6-22(32)36-24-19(29)9-10-20(24)30/h1-14H2 |
| InChIKey | VAFBDNQEDJYCKS-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 179.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|