C26H34N2O13 — CID 158788198
(2,5-dioxopyrrolidin-1-yl) 6-[2-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-2,6-dioxohexoxy]methyl]-3-ethenoxypropoxy]-5-oxohexanoate (PubChem CID 158788198) has the molecular formula C26H34N2O13 and a molecular weight of 582.56 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[2-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-2,6-dioxohexoxy]methyl]-3-ethenoxypropoxy]-5-oxohexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[2-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-2,6-dioxohexoxy]methyl]-3-ethenoxypropoxy]-5-oxohexanoate |
|---|---|
| PubChem CID | 158788198 |
| Molecular Formula | C26H34N2O13 |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[2-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-2,6-dioxohexoxy]methyl]-3-ethenoxypropoxy]-5-oxohexanoate |
| SMILES | C=COCC(COCC(=O)CCCC(=O)ON1C(=O)CCC1=O)COCC(=O)CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C26H34N2O13/c1-2-37-13-18(14-38-16-19(29)5-3-7-25(35)40-27-21(31)9-10-22(27)32)15-39-17-20(30)6-4-8-26(36)41-28-23(33)11-12-24(28)34/h2,18H,1,3-17H2 |
| InChIKey | XTYQHUFNZHVCDY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 189.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|