C11H15NO6 — CID 139256325
(2,5-dioxopyrrolidin-1-yl) 4-(3-oxopropoxy)butanoate (PubChem CID 139256325) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(3-oxopropoxy)butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(3-oxopropoxy)butanoate |
|---|---|
| PubChem CID | 139256325 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(3-oxopropoxy)butanoate |
| SMILES | O=CCCOCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H15NO6/c13-6-2-8-17-7-1-3-11(16)18-12-9(14)4-5-10(12)15/h6H,1-5,7-8H2 |
| InChIKey | HXGXUUMKQQGPKQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|