C15H20N2O8 — CID 144956392
(2,5-dioxopyrrolidin-1-yl) 6-oxohexanoate;1-methoxypyrrolidine-2,5-dione (PubChem CID 144956392) has the molecular formula C15H20N2O8 and a molecular weight of 356.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-oxohexanoate;1-methoxypyrrolidine-2,5-dione.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-oxohexanoate;1-methoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 144956392 |
| Molecular Formula | C15H20N2O8 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-oxohexanoate;1-methoxypyrrolidine-2,5-dione |
| SMILES | CON1C(=O)CCC1=O.O=CCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H13NO5.C5H7NO3/c12-7-3-1-2-4-10(15)16-11-8(13)5-6-9(11)14;1-9-6-4(7)2-3-5(6)8/h7H,1-6H2;2-3H2,1H3 |
| InChIKey | UNRYTKRNEDDCFP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|