C20H30N2O8 — CID 126540985
1-O-(2,5-dioxopyrrolidin-1-yl) 11-O-[methyl(4-oxobutanoyl)amino] undecanedioate (PubChem CID 126540985) has the molecular formula C20H30N2O8 and a molecular weight of 426.47 g/mol. Its IUPAC name is 1-O-(2,5-dioxopyrrolidin-1-yl) 11-O-[methyl(4-oxobutanoyl)amino] undecanedioate.
| Compound Name | 1-O-(2,5-dioxopyrrolidin-1-yl) 11-O-[methyl(4-oxobutanoyl)amino] undecanedioate |
|---|---|
| PubChem CID | 126540985 |
| Molecular Formula | C20H30N2O8 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 1-O-(2,5-dioxopyrrolidin-1-yl) 11-O-[methyl(4-oxobutanoyl)amino] undecanedioate |
| SMILES | CN(OC(=O)CCCCCCCCCC(=O)ON1C(=O)CCC1=O)C(=O)CCC=O |
| InChI | InChI=1S/C20H30N2O8/c1-21(16(24)10-9-15-23)29-19(27)11-7-5-3-2-4-6-8-12-20(28)30-22-17(25)13-14-18(22)26/h15H,2-14H2,1H3 |
| InChIKey | XFEZJQZVAPSHJR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|