C14H28N2O4 — CID 178100536
(2,5-dioxopyrrolidin-1-yl) 4-(dimethylamino)butanoate;ethane (PubChem CID 178100536) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(dimethylamino)butanoate;ethane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(dimethylamino)butanoate;ethane |
|---|---|
| PubChem CID | 178100536 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(dimethylamino)butanoate;ethane |
| SMILES | CC.CC.CN(C)CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H16N2O4.2C2H6/c1-11(2)7-3-4-10(15)16-12-8(13)5-6-9(12)14;2*1-2/h3-7H2,1-2H3;2*1-2H3 |
| InChIKey | QLAWKOLEXMKZQJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|