C13H21NO5 — CID 156842096
(2,5-dioxopyrrolidin-1-yl) 6-oxoheptanoate;ethane (PubChem CID 156842096) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-oxoheptanoate;ethane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-oxoheptanoate;ethane |
|---|---|
| PubChem CID | 156842096 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-oxoheptanoate;ethane |
| SMILES | CC.CC(=O)CCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H15NO5.C2H6/c1-8(13)4-2-3-5-11(16)17-12-9(14)6-7-10(12)15;1-2/h2-7H2,1H3;1-2H3 |
| InChIKey | HCWJJOVOPSWJBM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|