C24H34N2O12 — CID 167636990
(2,5-dioxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]butanoate;5-(3-oxobutoxy)pentan-2-one (PubChem CID 167636990) has the molecular formula C24H34N2O12 and a molecular weight of 542.54 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]butanoate;5-(3-oxobutoxy)pentan-2-one.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]butanoate;5-(3-oxobutoxy)pentan-2-one |
|---|---|
| PubChem CID | 167636990 |
| Molecular Formula | C24H34N2O12 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]butanoate;5-(3-oxobutoxy)pentan-2-one |
| SMILES | CC(=O)CCCOCCC(C)=O.O=C(CCCOCCC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H18N2O9.C9H16O3/c18-10-3-4-11(19)16(10)25-14(22)2-1-8-24-9-7-15(23)26-17-12(20)5-6-13(17)21;1-8(10)4-3-6-12-7-5-9(2)11/h1-9H2;3-7H2,1-2H3 |
| InChIKey | OPQVFLDUXDYSNZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 179.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|