C14H16N2O8 — CID 58472277
bis(2,5-dioxopyrrolidin-1-yl) (2S)-2-methylpentanedioate (PubChem CID 58472277) has the molecular formula C14H16N2O8 and a molecular weight of 340.29 g/mol. Its IUPAC name is bis(2,5-dioxopyrrolidin-1-yl) (2S)-2-methylpentanedioate.
| Compound Name | bis(2,5-dioxopyrrolidin-1-yl) (2S)-2-methylpentanedioate |
|---|---|
| PubChem CID | 58472277 |
| Molecular Formula | C14H16N2O8 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | bis(2,5-dioxopyrrolidin-1-yl) (2S)-2-methylpentanedioate |
| SMILES | C[C@@H](CCC(=O)ON1C(=O)CCC1=O)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H16N2O8/c1-8(14(22)24-16-11(19)5-6-12(16)20)2-7-13(21)23-15-9(17)3-4-10(15)18/h8H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | WWZXELADYMELIE-QMMMGPOBSA-N |
| XLogP | -0.38 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|