C14H21NO6 — CID 166007558
1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) 2-methylpentanedioate (PubChem CID 166007558) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) 2-methylpentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) 2-methylpentanedioate |
|---|---|
| PubChem CID | 166007558 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) 2-methylpentanedioate |
| SMILES | CC(CCC(=O)ON1C(=O)CCC1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21NO6/c1-9(13(19)20-14(2,3)4)5-8-12(18)21-15-10(16)6-7-11(15)17/h9H,5-8H2,1-4H3 |
| InChIKey | RDIAONOGUYAQPO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|