C16H24N2O7 — CID 162190830
(2,5-dioxopyrrolidin-1-yl) 4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxoheptanoate (PubChem CID 162190830) has the molecular formula C16H24N2O7 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxoheptanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxoheptanoate |
|---|---|
| PubChem CID | 162190830 |
| Molecular Formula | C16H24N2O7 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxoheptanoate |
| SMILES | CCC(=O)C(CCC(=O)ON1C(=O)CCC1=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24N2O7/c1-5-11(19)10(17-15(23)24-16(2,3)4)6-9-14(22)25-18-12(20)7-8-13(18)21/h10H,5-9H2,1-4H3,(H,17,23) |
| InChIKey | VKBYFWCNSIUEHU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|