C19H30N2O7 — CID 166869188
1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) 2-(2,3-dimethylbutanoylamino)pentanedioate (PubChem CID 166869188) has the molecular formula C19H30N2O7 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) 2-(2,3-dimethylbutanoylamino)pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) 2-(2,3-dimethylbutanoylamino)pentanedioate |
|---|---|
| PubChem CID | 166869188 |
| Molecular Formula | C19H30N2O7 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) 2-(2,3-dimethylbutanoylamino)pentanedioate |
| SMILES | CC(C)C(C)C(=O)NC(CCC(=O)ON1C(=O)CCC1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O7/c1-11(2)12(3)17(25)20-13(18(26)27-19(4,5)6)7-10-16(24)28-21-14(22)8-9-15(21)23/h11-13H,7-10H2,1-6H3,(H,20,25) |
| InChIKey | UQOQFGIPUQETJL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|