C35H60N4O10 — CID 154599884
ditert-butyl (2R)-2-[[(3S)-7-[[8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctanoyl]amino]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate (PubChem CID 154599884) has the molecular formula C35H60N4O10 and a molecular weight of 696.88 g/mol. Its IUPAC name is ditert-butyl (2R)-2-[[(3S)-7-[[8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctanoyl]amino]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2R)-2-[[(3S)-7-[[8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctanoyl]amino]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 154599884 |
| Molecular Formula | C35H60N4O10 |
| Molecular Weight | 696.88 g/mol |
| Exact Mass | 696.43 |
| IUPAC Name | ditert-butyl (2R)-2-[[(3S)-7-[[8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctanoyl]amino]-2,2-dimethylheptan-3-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](NC(=O)N[C@@H](CCCCNC(=O)CCCCCCC(=O)ON1C(=O)CCC1=O)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H60N4O10/c1-33(2,3)25(38-32(46)37-24(31(45)48-35(7,8)9)19-22-29(43)47-34(4,5)6)16-14-15-23-36-26(40)17-12-10-11-13-18-30(44)49-39-27(41)20-21-28(39)42/h24-25H,10-23H2,1-9H3,(H,36,40)(H2,37,38,46)/t24-,25+/m1/s1 |
| InChIKey | TWLFSYPKBJXEOJ-RPBOFIJWSA-N |
| XLogP | 4.77 |
| TPSA | 186.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|