C22H40N4O8 — CID 175122943
2-[[6-(6-aminohexanoylamino)-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid (PubChem CID 175122943) has the molecular formula C22H40N4O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-[[6-(6-aminohexanoylamino)-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[6-(6-aminohexanoylamino)-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 175122943 |
| Molecular Formula | C22H40N4O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-[[6-(6-aminohexanoylamino)-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid |
| SMILES | CC(C)(C)OC(=O)C(CCCCNC(=O)CCCCCN)NC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H40N4O8/c1-22(2,3)34-20(32)16(9-6-8-14-24-17(27)10-5-4-7-13-23)26-21(33)25-15(19(30)31)11-12-18(28)29/h15-16H,4-14,23H2,1-3H3,(H,24,27)(H,28,29)(H,30,31)(H2,25,26,33) |
| InChIKey | BSIOVENRXCWASM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 197.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|