C17H31N3O9 — CID 134210611
2-[[6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid;formic acid (PubChem CID 134210611) has the molecular formula C17H31N3O9 and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-[[6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid;formic acid.
| Compound Name | 2-[[6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid;formic acid |
|---|---|
| PubChem CID | 134210611 |
| Molecular Formula | C17H31N3O9 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-[[6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioic acid;formic acid |
| SMILES | CC(C)(C)OC(=O)C(CCCCN)NC(=O)NC(CCC(=O)O)C(=O)O.O=CO |
| InChI | InChI=1S/C16H29N3O7.CH2O2/c1-16(2,3)26-14(24)11(6-4-5-9-17)19-15(25)18-10(13(22)23)7-8-12(20)21;2-1-3/h10-11H,4-9,17H2,1-3H3,(H,20,21)(H,22,23)(H2,18,19,25);1H,(H,2,3) |
| InChIKey | KYFOXCHEAYPMKP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 205.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|