C24H39N3O5 — CID 138375877
tert-butyl (2S)-6-amino-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]carbamoylamino]hexanoate (PubChem CID 138375877) has the molecular formula C24H39N3O5 and a molecular weight of 449.59 g/mol. Its IUPAC name is tert-butyl (2S)-6-amino-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]carbamoylamino]hexanoate.
| Compound Name | tert-butyl (2S)-6-amino-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 138375877 |
| Molecular Formula | C24H39N3O5 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | tert-butyl (2S)-6-amino-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]carbamoylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCCN)NC(=O)N[C@@H](Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39N3O5/c1-23(2,3)31-20(28)18(14-10-11-15-25)26-22(30)27-19(21(29)32-24(4,5)6)16-17-12-8-7-9-13-17/h7-9,12-13,18-19H,10-11,14-16,25H2,1-6H3,(H2,26,27,30)/t18-,19-/m0/s1 |
| InChIKey | SOCXWRJYIHCAKN-OALUTQOASA-N |
| XLogP | 3.08 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|