C20H31N3O5 — CID 70500818
2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 70500818) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70500818 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H31N3O5/c1-20(2,3)28-19(27)23-15(11-7-8-12-21)17(24)22-16(18(25)26)13-14-9-5-4-6-10-14/h4-6,9-10,15-16H,7-8,11-13,21H2,1-3H3,(H,22,24)(H,23,27)(H,25,26)/t15-,16?/m0/s1 |
| InChIKey | LNCCCKHELSOVGL-VYRBHSGPSA-N |
| XLogP | 1.82 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|