C25H40N2O5 — CID 164740978
methyl (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoylamino]-3-phenylpropanoate (PubChem CID 164740978) has the molecular formula C25H40N2O5 and a molecular weight of 448.60 g/mol. Its IUPAC name is methyl (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 164740978 |
| Molecular Formula | C25H40N2O5 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | methyl (2S)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoylamino]-3-phenylpropanoate |
| SMILES | CCCCCCCCC(NC(=O)OC(C)(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C25H40N2O5/c1-6-7-8-9-10-14-17-20(27-24(30)32-25(2,3)4)22(28)26-21(23(29)31-5)18-19-15-12-11-13-16-19/h11-13,15-16,20-21H,6-10,14,17-18H2,1-5H3,(H,26,28)(H,27,30)/t20?,21-/m0/s1 |
| InChIKey | DWLPJCMGPPDVCX-LBAQZLPGSA-N |
| XLogP | 4.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|