C26H41N3O7 — CID 100984340
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]hexanoate (PubChem CID 100984340) has the molecular formula C26H41N3O7 and a molecular weight of 507.63 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]hexanoate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 100984340 |
| Molecular Formula | C26H41N3O7 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H41N3O7/c1-25(2,3)35-23(32)28-19(22(31)34-7)15-11-12-16-27-21(30)20(17-18-13-9-8-10-14-18)29-24(33)36-26(4,5)6/h8-10,13-14,19-20H,11-12,15-17H2,1-7H3,(H,27,30)(H,28,32)(H,29,33)/t19-,20-/m0/s1 |
| InChIKey | JIXSZTISZWFLOR-PMACEKPBSA-N |
| XLogP | 3.48 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|