C34H48N4O9 — CID 99658303
methyl (2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 99658303) has the molecular formula C34H48N4O9 and a molecular weight of 656.78 g/mol. Its IUPAC name is methyl (2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 99658303 |
| Molecular Formula | C34H48N4O9 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | methyl (2R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@@H](CCCCNC(=O)OCc1ccccc1)NC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H48N4O9/c1-34(2,3)47-33(43)38-27(19-11-13-21-35-31(41)45-23-25-15-7-5-8-16-25)29(39)37-28(30(40)44-4)20-12-14-22-36-32(42)46-24-26-17-9-6-10-18-26/h5-10,15-18,27-28H,11-14,19-24H2,1-4H3,(H,35,41)(H,36,42)(H,37,39)(H,38,43)/t27-,28+/m0/s1 |
| InChIKey | ZDAZTOCQAWNOCZ-WUFINQPMSA-N |
| XLogP | 4.73 |
| TPSA | 170.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|