C37H45N3O9 — CID 14752839
benzyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 14752839) has the molecular formula C37H45N3O9 and a molecular weight of 675.78 g/mol. Its IUPAC name is benzyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | benzyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 14752839 |
| Molecular Formula | C37H45N3O9 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | benzyl 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OCc1ccccc1)C(=O)NC(CCCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H45N3O9/c1-37(2,3)49-36(45)40-31(23-32(41)46-24-27-15-7-4-8-16-27)33(42)39-30(34(43)47-25-28-17-9-5-10-18-28)21-13-14-22-38-35(44)48-26-29-19-11-6-12-20-29/h4-12,15-20,30-31H,13-14,21-26H2,1-3H3,(H,38,44)(H,39,42)(H,40,45) |
| InChIKey | NBIUECYXUOCOSU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|