C34H40N2O8 — CID 91157508
dibenzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)heptanedioate (PubChem CID 91157508) has the molecular formula C34H40N2O8 and a molecular weight of 604.70 g/mol. Its IUPAC name is dibenzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)heptanedioate.
| Compound Name | dibenzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)heptanedioate |
|---|---|
| PubChem CID | 91157508 |
| Molecular Formula | C34H40N2O8 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | dibenzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)heptanedioate |
| SMILES | CC(C)(C)OC(=O)NC(CCCC(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H40N2O8/c1-34(2,3)44-33(40)36-29(31(38)42-23-26-16-9-5-10-17-26)21-13-20-28(30(37)41-22-25-14-7-4-8-15-25)35-32(39)43-24-27-18-11-6-12-19-27/h4-12,14-19,28-29H,13,20-24H2,1-3H3,(H,35,39)(H,36,40) |
| InChIKey | UEMQAYWGHKGFNO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|