C18H27NO4 — CID 14420168
benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 14420168) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 14420168 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CCCC[C@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO4/c1-5-6-12-15(19-17(21)23-18(2,3)4)16(20)22-13-14-10-8-7-9-11-14/h7-11,15H,5-6,12-13H2,1-4H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | NYUVHXYZMPPALF-HNNXBMFYSA-N |
| XLogP | 3.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |