C34H56N4O9 — CID 175137065
benzyl 2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 175137065) has the molecular formula C34H56N4O9 and a molecular weight of 664.84 g/mol. Its IUPAC name is benzyl 2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | benzyl 2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 175137065 |
| Molecular Formula | C34H56N4O9 |
| Molecular Weight | 664.84 g/mol |
| Exact Mass | 664.40 |
| IUPAC Name | benzyl 2-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H56N4O9/c1-32(2,3)45-29(41)35-21-15-13-19-25(38-31(43)47-34(7,8)9)27(39)37-26(28(40)44-23-24-17-11-10-12-18-24)20-14-16-22-36-30(42)46-33(4,5)6/h10-12,17-18,25-26H,13-16,19-23H2,1-9H3,(H,35,41)(H,36,42)(H,37,39)(H,38,43)/t25-,26?/m0/s1 |
| InChIKey | MSYWOPJOOZXKLW-PMCHYTPCSA-N |
| XLogP | 5.50 |
| TPSA | 170.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.84 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|