C31H43N3O7 — CID 178180173
benzyl (2S)-3-methyl-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoyl]amino]butanoate (PubChem CID 178180173) has the molecular formula C31H43N3O7 and a molecular weight of 569.70 g/mol. Its IUPAC name is benzyl (2S)-3-methyl-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoyl]amino]butanoate.
| Compound Name | benzyl (2S)-3-methyl-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoyl]amino]butanoate |
|---|---|
| PubChem CID | 178180173 |
| Molecular Formula | C31H43N3O7 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | benzyl (2S)-3-methyl-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H43N3O7/c1-22(2)26(28(36)39-20-23-14-8-6-9-15-23)34-27(35)25(18-12-13-19-32-29(37)41-31(3,4)5)33-30(38)40-21-24-16-10-7-11-17-24/h6-11,14-17,22,25-26H,12-13,18-21H2,1-5H3,(H,32,37)(H,33,38)(H,34,35)/t25-,26-/m0/s1 |
| InChIKey | KAXXWOCICFFLRC-UIOOFZCWSA-N |
| XLogP | 4.86 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|