C37H47N3O8 — CID 175774912
benzyl (2S,3R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-3-phenylmethoxybutanoate (PubChem CID 175774912) has the molecular formula C37H47N3O8 and a molecular weight of 661.80 g/mol. Its IUPAC name is benzyl (2S,3R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-3-phenylmethoxybutanoate.
| Compound Name | benzyl (2S,3R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-3-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 175774912 |
| Molecular Formula | C37H47N3O8 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.34 |
| IUPAC Name | benzyl (2S,3R)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]-3-phenylmethoxybutanoate |
| SMILES | C[C@@H](OCc1ccccc1)[C@H](NC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H47N3O8/c1-27(45-24-28-16-8-5-9-17-28)32(34(42)46-25-29-18-10-6-11-19-29)40-33(41)31(39-36(44)48-37(2,3)4)22-14-15-23-38-35(43)47-26-30-20-12-7-13-21-30/h5-13,16-21,27,31-32H,14-15,22-26H2,1-4H3,(H,38,43)(H,39,44)(H,40,41)/t27-,31+,32+/m1/s1 |
| InChIKey | RZNRJXPSNHIDAA-DUQIMVFOSA-N |
| XLogP | 5.81 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|