C27H37N3O6 — CID 91271817
benzyl N-[(2S)-1-[2-(2-hydroxyphenyl)ethylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate (PubChem CID 91271817) has the molecular formula C27H37N3O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-(2-hydroxyphenyl)ethylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-(2-hydroxyphenyl)ethylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 91271817 |
| Molecular Formula | C27H37N3O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | benzyl N-[(2S)-1-[2-(2-hydroxyphenyl)ethylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)NCCc1ccccc1O |
| InChI | InChI=1S/C27H37N3O6/c1-27(2,3)36-25(33)29-17-10-9-14-22(30-26(34)35-19-20-11-5-4-6-12-20)24(32)28-18-16-21-13-7-8-15-23(21)31/h4-8,11-13,15,22,31H,9-10,14,16-19H2,1-3H3,(H,28,32)(H,29,33)(H,30,34)/t22-/m0/s1 |
| InChIKey | SKRFIXZFRDIWTD-QFIPXVFZSA-N |
| XLogP | 4.04 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|