C26H42N4O6 — CID 110189169
benzyl N-[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(3-morpholin-4-ylpropylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 110189169) has the molecular formula C26H42N4O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is benzyl N-[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(3-morpholin-4-ylpropylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(3-morpholin-4-ylpropylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 110189169 |
| Molecular Formula | C26H42N4O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | benzyl N-[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(3-morpholin-4-ylpropylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C26H42N4O6/c1-26(2,3)36-24(32)28-13-8-7-12-22(29-25(33)35-20-21-10-5-4-6-11-21)23(31)27-14-9-15-30-16-18-34-19-17-30/h4-6,10-11,22H,7-9,12-20H2,1-3H3,(H,27,31)(H,28,32)(H,29,33)/t22-/m0/s1 |
| InChIKey | FGHWQUIUMJSHLW-QFIPXVFZSA-N |
| XLogP | 2.81 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|