C22H35N3O5 — CID 10502292
benzyl N-[(2S)-4-methyl-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-1-oxopentan-2-yl]carbamate (PubChem CID 10502292) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is benzyl N-[(2S)-4-methyl-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-4-methyl-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 10502292 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | benzyl N-[(2S)-4-methyl-1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O5/c1-16(2)14-18(25-21(28)29-15-17-10-7-6-8-11-17)19(26)23-12-9-13-24-20(27)30-22(3,4)5/h6-8,10-11,16,18H,9,12-15H2,1-5H3,(H,23,26)(H,24,27)(H,25,28)/t18-/m0/s1 |
| InChIKey | JGYRAUWARLJDHA-SFHVURJKSA-N |
| XLogP | 3.36 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|