C23H37N3O5 — CID 59008207
tert-butyl N-methyl-N-[3-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]propyl]carbamate (PubChem CID 59008207) has the molecular formula C23H37N3O5 and a molecular weight of 435.57 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[3-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[3-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 59008207 |
| Molecular Formula | C23H37N3O5 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | tert-butyl N-methyl-N-[3-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]propyl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)NCCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37N3O5/c1-17(2)15-19(25-21(28)30-16-18-11-8-7-9-12-18)20(27)24-13-10-14-26(6)22(29)31-23(3,4)5/h7-9,11-12,17,19H,10,13-16H2,1-6H3,(H,24,27)(H,25,28)/t19-/m0/s1 |
| InChIKey | IEWLIYQXZUMPKE-IBGZPJMESA-N |
| XLogP | 3.70 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|