C17H28ClN3O3 — CID 44512972
benzyl N-[(2S)-1-(3-aminopropylamino)-4-methyl-1-oxopentan-2-yl]carbamate;hydrochloride (PubChem CID 44512972) has the molecular formula C17H28ClN3O3 and a molecular weight of 357.88 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(3-aminopropylamino)-4-methyl-1-oxopentan-2-yl]carbamate;hydrochloride.
| Compound Name | benzyl N-[(2S)-1-(3-aminopropylamino)-4-methyl-1-oxopentan-2-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 44512972 |
| Molecular Formula | C17H28ClN3O3 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | benzyl N-[(2S)-1-(3-aminopropylamino)-4-methyl-1-oxopentan-2-yl]carbamate;hydrochloride |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)NCCCN.Cl |
| InChI | InChI=1S/C17H27N3O3.ClH/c1-13(2)11-15(16(21)19-10-6-9-18)20-17(22)23-12-14-7-4-3-5-8-14;/h3-5,7-8,13,15H,6,9-12,18H2,1-2H3,(H,19,21)(H,20,22);1H/t15-;/m0./s1 |
| InChIKey | QUFDHWCDMSRLIX-RSAXXLAASA-N |
| XLogP | 2.21 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|