C21H34N2O5 — CID 59065878
benzyl N-[(2S)-1-(3,3-diethoxypropylamino)-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 59065878) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(3,3-diethoxypropylamino)-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(3,3-diethoxypropylamino)-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 59065878 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | benzyl N-[(2S)-1-(3,3-diethoxypropylamino)-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCOC(CCNC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C21H34N2O5/c1-5-26-19(27-6-2)12-13-22-20(24)18(14-16(3)4)23-21(25)28-15-17-10-8-7-9-11-17/h7-11,16,18-19H,5-6,12-15H2,1-4H3,(H,22,24)(H,23,25)/t18-/m0/s1 |
| InChIKey | FVFDXQWBFLNQSY-SFHVURJKSA-N |
| XLogP | 3.23 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|