C17H27N3O3 — CID 162739110
benzyl N-[(2S)-4-methyl-1-oxo-1-(2-propylhydrazinyl)pentan-2-yl]carbamate (PubChem CID 162739110) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is benzyl N-[(2S)-4-methyl-1-oxo-1-(2-propylhydrazinyl)pentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-4-methyl-1-oxo-1-(2-propylhydrazinyl)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 162739110 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | benzyl N-[(2S)-4-methyl-1-oxo-1-(2-propylhydrazinyl)pentan-2-yl]carbamate |
| SMILES | CCCNNC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H27N3O3/c1-4-10-18-20-16(21)15(11-13(2)3)19-17(22)23-12-14-8-6-5-7-9-14/h5-9,13,15,18H,4,10-12H2,1-3H3,(H,19,22)(H,20,21)/t15-/m0/s1 |
| InChIKey | CEVWTABNDNWSMA-HNNXBMFYSA-N |
| XLogP | 2.36 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|