C19H29N3O5 — CID 162739094
benzyl N-[(2S)-4-methyl-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-1-oxopentan-2-yl]carbamate (PubChem CID 162739094) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is benzyl N-[(2S)-4-methyl-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-4-methyl-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 162739094 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | benzyl N-[(2S)-4-methyl-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29N3O5/c1-13(2)11-15(16(23)21-22-18(25)27-19(3,4)5)20-17(24)26-12-14-9-7-6-8-10-14/h6-10,13,15H,11-12H2,1-5H3,(H,20,24)(H,21,23)(H,22,25)/t15-/m0/s1 |
| InChIKey | VVALNADLGHDZOR-HNNXBMFYSA-N |
| XLogP | 2.88 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|