C17H24N4O6 — CID 71436679
benzyl N-[4-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 71436679) has the molecular formula C17H24N4O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is benzyl N-[4-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[4-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 71436679 |
| Molecular Formula | C17H24N4O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | benzyl N-[4-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)C(CC(N)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N4O6/c1-17(2,3)27-16(25)21-20-14(23)12(9-13(18)22)19-15(24)26-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H2,18,22)(H,19,24)(H,20,23)(H,21,25) |
| InChIKey | LFEPYWKDIHUICL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|