C20H29NO6 — CID 14379015
4-O-benzyl 1-O-tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 14379015) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 14379015 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO6/c1-19(2,3)26-17(23)15(21-18(24)27-20(4,5)6)12-16(22)25-13-14-10-8-7-9-11-14/h7-11,15H,12-13H2,1-6H3,(H,21,24) |
| InChIKey | BFROBHITTVOPDW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|