C16H22N2O4S — CID 10088509
benzyl 4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidenebutanoate (PubChem CID 10088509) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is benzyl 4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidenebutanoate.
| Compound Name | benzyl 4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidenebutanoate |
|---|---|
| PubChem CID | 10088509 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | benzyl 4-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidenebutanoate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OCc1ccccc1)C(N)=S |
| InChI | InChI=1S/C16H22N2O4S/c1-16(2,3)22-15(20)18-12(14(17)23)9-13(19)21-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H2,17,23)(H,18,20) |
| InChIKey | OVCCFPCJGCKGSI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|