C26H34N2O7 — CID 20759870
benzyl 4-(3,3-diethoxypropylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 20759870) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is benzyl 4-(3,3-diethoxypropylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | benzyl 4-(3,3-diethoxypropylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 20759870 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | benzyl 4-(3,3-diethoxypropylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CCOC(CCNC(=O)C(CC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C26H34N2O7/c1-3-32-24(33-4-2)15-16-27-25(30)22(17-23(29)34-18-20-11-7-5-8-12-20)28-26(31)35-19-21-13-9-6-10-14-21/h5-14,22,24H,3-4,15-19H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | LUWNOTTVPHCQPA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|